Compound Q&A

What industries use Hypericumperforatum extracts (CAS: 84082-80-4)?

Answer

Hypericumperforatumextracts
Hypericumperforatum extracts are widely used in the pharmaceutical industry for their potential health benefits. They are also utilized in the cosmetic industry for skin care products. Additionally, these extracts are sometimes employed in the food industry as natural colorants and flavor enhancers. Their unique properties make them valuable in the production of natural health products and dietary supplements.

About

CAS No 84082-80-4
English Name Hypericumperforatumextracts
Molecular Formula C18H16N2O3
Molecular Weight 308.33 g/mol
EINECS 282-026-4
SMILES OC1=C(C(N(C)C2C=CC=CC=2)=O)C(N(C)C2C=CC=CC=21)=O
InChIKey SGOOQMRIPALTEL-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hypericumperforatum extracts (CAS: 84082-80-4)?

Hypericumperforatum extracts are known for their distinctive green color. They have a molecular weig...

Compound Q&A

How is Hypericumperforatum extract (CAS: 84082-80-4) typically synthesized?

Hypericumperforatum extract is commonly synthesized through fermentation processes. Yeast and bacter...

Compound Q&A

What precautions should be taken when handling Hypericumperforatum extracts (CAS: 84082-80-4)?

When handling Hypericumperforatum extracts, it is recommended to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...