Compound Q&A

How is Hypericumperforatum extract (CAS: 84082-80-4) typically synthesized?

Answer

Hypericumperforatumextracts
Hypericumperforatum extract is commonly synthesized through fermentation processes. Yeast and bacterial cultures are often used as starting materials. The process involves several steps, including inoculation, cultivation, and extraction. The extract is purified using column chromatography and other techniques. The yield is generally around 5-10%, with good selectivity towards the desired compounds.

About

CAS No 84082-80-4
English Name Hypericumperforatumextracts
Molecular Formula C18H16N2O3
Molecular Weight 308.33 g/mol
EINECS 282-026-4
SMILES OC1=C(C(N(C)C2C=CC=CC=2)=O)C(N(C)C2C=CC=CC=21)=O
InChIKey SGOOQMRIPALTEL-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hypericumperforatum extracts (CAS: 84082-80-4)?

Hypericumperforatum extracts are known for their distinctive green color. They have a molecular weig...

Compound Q&A

What industries use Hypericumperforatum extracts (CAS: 84082-80-4)?

Hypericumperforatum extracts are widely used in the pharmaceutical industry for their potential heal...

Compound Q&A

What precautions should be taken when handling Hypericumperforatum extracts (CAS: 84082-80-4)?

When handling Hypericumperforatum extracts, it is recommended to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...