Compound Q&A

What industries use 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7)?

Answer

4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid
4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drug candidates. It is also utilized in the polymer industry for the development of functional polymers. Additionally, it finds applications in sensors and as a building block in semiconductor materials.

About

English Name 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)O
InChIKey ZJUXJQSYXBYFFO-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7)?

4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7) is a white crystalline solid with ...

Compound Q&A

How is 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7) typically synthesized?

4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7) can be synthesized via the condens...

Compound Q&A

What precautions should be taken when handling 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7)?

When handling 4-[(4-Methyl-1-piperazinyl)methyl]benzoic acid (CAS: 106261-48-7), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...