Compound Q&A

What industries use Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5)?

Answer

Lorcaserin Hydrochloride Hemihydrate
Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5) is primarily used in the pharmaceutical industry for the treatment of obesity. It has also shown potential in other applications, such as in the development of sensors and as a component in certain polymers.

About

English Name Lorcaserin Hydrochloride Hemihydrate
Molecular Formula 2[C11H14NCl].2[HCl].H2O
Molecular Weight 482.31 g/mol
SMILES C[C@H]1CNCCC2=C1C=C(C=C2)Cl.Cl.O
InChIKey NBENLXSMFWRJRU-JZGIKJSDSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5)?

Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5) is a white or off-white crystalline powder. ...

Compound Q&A

How is Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5) typically synthesized?

Lorcaserin Hydrochloride Hemihydrate is typically synthesized through a multi-step process involving...

Compound Q&A

What precautions should be taken when handling Lorcaserin Hydrochloride Hemihydrate (CAS: 856681-05-5)?

Lorcaserin Hydrochloride Hemihydrate should be handled in a well-ventilated area or a fume hood to a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...