Compound Q&A

How is 1-bromo-9H-carbazole (CAS: 16807-11-7) typically synthesized?

Answer

1-bromo-9H-carbazole
1-Bromo-9H-carbazole is typically synthesized by bromination of carbazole. The reaction is usually performed in the presence of a Lewis acid catalyst, such as AlCl3. The yield is generally high, and the product can be isolated by column chromatography. The reaction is selective and provides a high degree of purity.

About

CAS No 16807-11-7
English Name 1-bromo-9H-carbazole
Molecular Formula C12H8BrN
Molecular Weight 246.11 g/mol
SMILES C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br
InChIKey VCDOOGZTWDOHEB-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-bromo-9H-carbazole (CAS: 16807-11-7)?

1-Bromo-9H-carbazole is a solid with a crystalline form. Its molecular weight is approximately 221.0...

Compound Q&A

What industries use 1-bromo-9H-carbazole (CAS: 16807-11-7)?

1-Bromo-9H-carbazole is used in the pharmaceutical industry for the synthesis of drugs that require ...

Compound Q&A

What precautions should be taken when handling 1-bromo-9H-carbazole (CAS: 16807-11-7)?

When handling 1-bromo-9H-carbazole, it is important to use appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...