Compound Q&A

What are the physical and chemical properties of 1-bromo-9H-carbazole (CAS: 16807-11-7)?

Answer

1-bromo-9H-carbazole
1-Bromo-9H-carbazole is a solid with a crystalline form. Its molecular weight is approximately 221.04 g/mol. This compound is poorly soluble in water but soluble in organic solvents like chloroform and ethanol. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It is used in the synthesis of other compounds due to its aromatic nature and the presence of a bromine substituent.

About

CAS No 16807-11-7
English Name 1-bromo-9H-carbazole
Molecular Formula C12H8BrN
Molecular Weight 246.11 g/mol
SMILES C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br
InChIKey VCDOOGZTWDOHEB-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 1-bromo-9H-carbazole (CAS: 16807-11-7) typically synthesized?

1-Bromo-9H-carbazole is typically synthesized by bromination of carbazole. The reaction is usually p...

Compound Q&A

What industries use 1-bromo-9H-carbazole (CAS: 16807-11-7)?

1-Bromo-9H-carbazole is used in the pharmaceutical industry for the synthesis of drugs that require ...

Compound Q&A

What precautions should be taken when handling 1-bromo-9H-carbazole (CAS: 16807-11-7)?

When handling 1-bromo-9H-carbazole, it is important to use appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...