Compound Q&A

What industries use Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

Answer

Ethyl (4-nitrophenyl)acetate
Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is primarily used in the pharmaceutical industry for the synthesis of various drugs and intermediates. It is also utilized in the production of organic pigments, dyes, and other chemical intermediates. Additionally, this compound has applications in the research and development of new materials, such as polymers and semiconductors.

About

CAS No 5445-26-1
English Name Ethyl (4-nitrophenyl)acetate
Molecular Formula C10H11NO4
Molecular Weight 209.2 g/mol
SMILES CCOC(=O)CC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey DWDRNKYLWMKWTH-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) typically synthesized?

Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is typically synthesized by the esterification of 4-ni...

Compound Q&A

What precautions should be taken when handling Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

When handling Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1), it is crucial to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...