Compound Q&A

How is Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) typically synthesized?

Answer

Ethyl (4-nitrophenyl)acetate
Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is typically synthesized by the esterification of 4-nitrophenol with acetic anhydride in the presence of a strong acid catalyst like sulfuric acid. The reaction is carried out at elevated temperatures to achieve high yield and selectivity. This compound can also be prepared by other methods, such as direct nitration of ethyl phenylacetate, followed by purification.

About

CAS No 5445-26-1
English Name Ethyl (4-nitrophenyl)acetate
Molecular Formula C10H11NO4
Molecular Weight 209.2 g/mol
SMILES CCOC(=O)CC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey DWDRNKYLWMKWTH-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is a crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1)?

When handling Ethyl (4-nitrophenyl)acetate (CAS: 5445-26-1), it is crucial to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...