Compound Q&A

What industries use 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

Answer

2,4-Dimethoxybenzoic acid
2,4-Dimethoxybenzoic acid (CAS: 91-52-1) is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the production of antihistamines and analgesics. It also finds applications in the polymer industry for the development of new materials, and in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 91-52-1
English Name 2,4-Dimethoxybenzoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=CC(=C(C=C1)C(=O)O)OC
InChIKey GPVDHNVGGIAOQT-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

2,4-Dimethoxybenzoic acid (CAS: 91-52-1) is a white or off-white crystalline solid. The molecular we...

Compound Q&A

How is 2,4-Dimethoxybenzoic acid (CAS: 91-52-1) typically synthesized?

2,4-Dimethoxybenzoic acid is typically synthesized through the nitration of m-dimethylphenol followe...

Compound Q&A

What precautions should be taken when handling 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

When handling 2,4-Dimethoxybenzoic acid (CAS: 91-52-1), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...