Compound Q&A

How is 2,4-Dimethoxybenzoic acid (CAS: 91-52-1) typically synthesized?

Answer

2,4-Dimethoxybenzoic acid
2,4-Dimethoxybenzoic acid is typically synthesized through the nitration of m-dimethylphenol followed by reduction of the nitro group. A common method involves reacting m-dimethylphenol with nitric acid in the presence of sulfuric acid as a catalyst. The nitro group is then reduced to an amino group using sodium borohydride, followed by oxidation to the carboxylic acid group.

About

CAS No 91-52-1
English Name 2,4-Dimethoxybenzoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=CC(=C(C=C1)C(=O)O)OC
InChIKey GPVDHNVGGIAOQT-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

2,4-Dimethoxybenzoic acid (CAS: 91-52-1) is a white or off-white crystalline solid. The molecular we...

Compound Q&A

What industries use 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

2,4-Dimethoxybenzoic acid (CAS: 91-52-1) is used in various industries. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling 2,4-Dimethoxybenzoic acid (CAS: 91-52-1)?

When handling 2,4-Dimethoxybenzoic acid (CAS: 91-52-1), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...