Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3) typically synthesized?

Answer

2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3) is typically synthesized via a multistep process involving the formation of an intermediate pyrrolidine derivative followed by carbamoylation. This process often involves the use of EDC (N,N'-carbonyldiimidazole) as a coupling agent and a base such as triethylamine. The overall yield is moderate to good, and the reaction is carried out under mild conditions to maintain the stereochemistry at the chiral center.

About

CAS No 35150-07-3
English Name 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate
Molecular Formula C10H18N2O3
Molecular Weight 214.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC1C(=O)N
InChIKey PITJAAIPVBVRAO-ZETCQYMHSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3)?

2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3) is a crystalline com...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3)?

2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3) is used in the pharm...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3)?

When handling 2-Methyl-2-propanyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate (CAS: 35150-07-3), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...