Compound Q&A

What industries use 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

Answer

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate
2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a monomer for producing special polymers and in the sensor industry as a functional group for detector elements. Additionally, it may be used in the semiconductor industry for specific chemical processes.

About

CAS No 66605-57-0
English Name 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate
Molecular Formula C14H21NO3
Molecular Weight 251.33 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CO
InChIKey LDKDMDVMMCXTMO-LBPRGKRZSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is a colorless or light yellow liq...

Compound Q&A

How is 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0) typically synthesized?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is typically synthesized via a con...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

When handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate, it is crucial to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...