Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

Answer

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate
2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is a colorless or light yellow liquid with a molecular weight of approximately 287.35 g/mol. It has a pKa of about 8.5, making it slightly basic. The compound is only slightly soluble in water but more soluble in organic solvents like ethanol, acetone, and chloroform. It is reactive towards nucleophiles and can undergo substitution reactions under certain conditions.

About

CAS No 66605-57-0
English Name 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate
Molecular Formula C14H21NO3
Molecular Weight 251.33 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CO
InChIKey LDKDMDVMMCXTMO-LBPRGKRZSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0) typically synthesized?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is typically synthesized via a con...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate (CAS: 66605-57-0)?

When handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate, it is crucial to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...