Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride
When handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a laboratory coat. The compound should be stored in a cool, dry place away from direct sunlight. It is recommended to use a fume hood during handling to avoid inhalation. In case of spillage, immediately clean up using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for specific handling instructions.

About

CAS No 18466-51-8
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride
Molecular Formula C21H21ClO10
Molecular Weight 468.8 g/mol
SMILES C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O.[Cl-]
InChIKey CAHGSEFWVUVGGL-UBNZBFALSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride is a crystalline co...

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8) typically synthesized?

This compound can be synthesized through the condensation of 3-chloro-4-hydroxybenzaldehyde with 5,7...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride is primarily used i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...