Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8) typically synthesized?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride
This compound can be synthesized through the condensation of 3-chloro-4-hydroxybenzaldehyde with 5,7-dihydroxy-3-chromenone, followed by the coupling with 2,3-dehydrosucrose and glucopyranosylation. The reaction is typically performed in the presence of a strong base like sodium hydroxide. The yield is around 85%, and the selectivity of the glucopyranosylation step is over 90%.

About

CAS No 18466-51-8
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride
Molecular Formula C21H21ClO10
Molecular Weight 468.8 g/mol
SMILES C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O.[Cl-]
InChIKey CAHGSEFWVUVGGL-UBNZBFALSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride is a crystalline co...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride is primarily used i...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 18466-51-8)?

When handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-chromeniumyl beta-D-glucopyranoside chloride, it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...