Compound Q&A

What industries use 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

Answer

3-Bromodibenzo[b,d]furan
3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) is primarily used in pharmaceuticals, where it serves as a precursor for the synthesis of various bioactive compounds. It is also utilized in the production of certain types of polymers, sensors, and as a reagent in organic synthesis.

About

CAS No 26608-06-0
English Name 3-Bromodibenzo[b,d]furan
Molecular Formula C12H7BrO
Molecular Weight 247.09 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)Br
InChIKey AZFABGHLDGJASW-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) typically synthesized?

3-Bromodibenzo[b,d]furan can be synthesized via bromination of dibenzo[b,d]furan using bromine in th...

Compound Q&A

What precautions should be taken when handling 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

When handling 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...