Compound Q&A

What are the physical and chemical properties of 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

Answer

3-Bromodibenzo[b,d]furan
3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) is a crystalline compound with a molecular weight of approximately 256.03 g/mol. It is poorly soluble in water but soluble in common organic solvents such as dichloromethane and ethanol. This compound is highly reactive towards nucleophiles due to the presence of the bromine substituent and undergoes electrophilic aromatic substitution reactions easily.

About

CAS No 26608-06-0
English Name 3-Bromodibenzo[b,d]furan
Molecular Formula C12H7BrO
Molecular Weight 247.09 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)Br
InChIKey AZFABGHLDGJASW-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) typically synthesized?

3-Bromodibenzo[b,d]furan can be synthesized via bromination of dibenzo[b,d]furan using bromine in th...

Compound Q&A

What industries use 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

3-Bromodibenzo[b,d]furan (CAS: 26608-06-0) is primarily used in pharmaceuticals, where it serves as ...

Compound Q&A

What precautions should be taken when handling 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0)?

When handling 3-Bromodibenzo[b,d]furan (CAS: 26608-06-0), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...