Compound Q&A

What precautions should be taken when handling 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

Answer

1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine
Handling 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine requires appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be performed in a well-ventilated area or a fume hood due to its potential to irritate the respiratory system. In case of a spill, it should be handled according to the Safety Data Sheet (SDS) guidelines, which may include the use of absorbent materials and proper disposal methods.

About

English Name 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine
Molecular Formula C19H27ClN2
Molecular Weight 318.89 g/mol
SMILES CC1(C)CCC(=C(C1)c2ccc(Cl)cc2)CN3CCNCC3
InChIKey YCNNHDUZLQPKJY-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine has a molecular weight of ap...

Compound Q&A

How is 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0) typically synthesized?

This compound is typically synthesized via a multi-step process involving the reaction of 4-chloroph...

Compound Q&A

What industries use 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine finds applications in the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...