Compound Q&A

What are the physical and chemical properties of 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

Answer

1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine
1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine has a molecular weight of approximately 381.1 g/mol and is crystalline at room temperature. It is poorly water-soluble but soluble in common organic solvents like DMSO and DMF. Chemically, it is stable under normal conditions but may react with strong acids or bases. It does not have significant reactivity with common laboratory chemicals.

About

English Name 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine
Molecular Formula C19H27ClN2
Molecular Weight 318.89 g/mol
SMILES CC1(C)CCC(=C(C1)c2ccc(Cl)cc2)CN3CCNCC3
InChIKey YCNNHDUZLQPKJY-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0) typically synthesized?

This compound is typically synthesized via a multi-step process involving the reaction of 4-chloroph...

Compound Q&A

What industries use 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine finds applications in the ph...

Compound Q&A

What precautions should be taken when handling 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine (CAS: 1228780-72-0)?

Handling 1-{[2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl}piperazine requires appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...