Compound Q&A

What industries use (2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid (CAS: 19728-63-3)?

Answer

(2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid
(2S,3R)-2-{[(Benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid finds applications in the pharmaceutical industry, particularly in the synthesis of prodrugs and intermediates for drug development. It is also used in the chemical and polymer industries for the production of functionalized polymers and as a precursor in the synthesis of various compounds with specific reactivity profiles.

About

CAS No 19728-63-3
English Name (2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid
Molecular Formula C12H15NO5
Molecular Weight 253.25 g/mol
SMILES CC(C(C(=O)O)NC(=O)OCC1=CC=CC=C1)O
InChIKey IPJUIRDNBFZGQN-SCZZXKLOSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid (CAS: 19728-63-3)?

(2S,3R)-2-{[(Benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid is a white crystalline solid with a mo...

Compound Q&A

How is (2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid (CAS: 19728-63-3) typically synthesized?

(2S,3R)-2-{[(Benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid can be synthesized via a multi-step pr...

Compound Q&A

What precautions should be taken when handling (2S,3R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid (CAS: 19728-63-3)?

When handling (2S,3R)-2-{[(Benzyloxy)carbonyl]amino}-3-hydroxybutanoic acid, it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...