Compound Q&A

How is isoeugenyl acetate (CAS: 93-29-8) typically synthesized?

Answer

Isoeugenyl acetate
Isoeugenyl acetate (CAS: 93-29-8) is typically synthesized by the esterification of eugenol with acetic anhydride in the presence of a catalyst such as sulfuric acid. The reaction is carried out under reflux conditions, and the product is purified by distillation. The yield is usually around 90%, with high selectivity towards the ester formation.

About

CAS No 93-29-8
English Name Isoeugenyl acetate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC=CC1=CC(=C(C=C1)OC(=O)C)OC
InChIKey IUSBVFZKQJGVEP-PLNGDYQASA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of isoeugenyl acetate (CAS: 93-29-8)?

Isoeugenyl acetate (CAS: 93-29-8) is a colorless to yellowish liquid with a molecular weight of appr...

Compound Q&A

What industries use isoeugenyl acetate (CAS: 93-29-8)?

Isoeugenyl acetate (CAS: 93-29-8) is primarily used in the fragrance and perfume industry due to its...

Compound Q&A

What precautions should be taken when handling isoeugenyl acetate (CAS: 93-29-8)?

When handling isoeugenyl acetate (CAS: 93-29-8), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...