Compound Q&A

What are the physical and chemical properties of isoeugenyl acetate (CAS: 93-29-8)?

Answer

Isoeugenyl acetate
Isoeugenyl acetate (CAS: 93-29-8) is a colorless to yellowish liquid with a molecular weight of approximately 210.27 g/mol. It is slightly soluble in water but miscible with most organic solvents. Chemically, it is stable but can react with strong bases. Its specific gravity is around 0.902. It is used in the fragrance industry due to its pleasant aroma.

About

CAS No 93-29-8
English Name Isoeugenyl acetate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC=CC1=CC(=C(C=C1)OC(=O)C)OC
InChIKey IUSBVFZKQJGVEP-PLNGDYQASA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is isoeugenyl acetate (CAS: 93-29-8) typically synthesized?

Isoeugenyl acetate (CAS: 93-29-8) is typically synthesized by the esterification of eugenol with ace...

Compound Q&A

What industries use isoeugenyl acetate (CAS: 93-29-8)?

Isoeugenyl acetate (CAS: 93-29-8) is primarily used in the fragrance and perfume industry due to its...

Compound Q&A

What precautions should be taken when handling isoeugenyl acetate (CAS: 93-29-8)?

When handling isoeugenyl acetate (CAS: 93-29-8), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...