Compound Q&A

What industries use 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

Answer

3-Iodo-6-nitro-1H-indazole
3-Iodo-6-nitro-1H-indazole is primarily used in the pharmaceutical industry for the development of potential drug candidates. It is also explored in the field of materials science for its unique electronic properties, making it useful in the synthesis of certain semiconductors. Additionally, it has shown promise in sensor technology due to its reactivity and stability.

About

CAS No 70315-70-7
English Name 3-Iodo-6-nitro-1H-indazole
Molecular Formula C7H4IN3O2
Molecular Weight 289.03 g/mol
SMILES C1=CC2=C(NN=C2C=C1[N+](=O)[O-])I
InChIKey GZCGNGLOCQEDMT-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

3-Iodo-6-nitro-1H-indazole is a crystalline solid with a molecular weight of approximately 268.03 g/...

Compound Q&A

How is 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7) typically synthesized?

3-Iodo-6-nitro-1H-indazole can be synthesized via the nitration of 3-bromo-1H-indazole followed by i...

Compound Q&A

What precautions should be taken when handling 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

When handling 3-Iodo-6-nitro-1H-indazole, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...