Compound Q&A

How is 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7) typically synthesized?

Answer

3-Iodo-6-nitro-1H-indazole
3-Iodo-6-nitro-1H-indazole can be synthesized via the nitration of 3-bromo-1H-indazole followed by iodination. Common procedures involve the use of nitric acid and sulfuric acid as reagents for nitration, and iodine or iodic acid for the iodination step. The synthesis usually achieves good to moderate yields depending on the purity of starting materials and reaction conditions.

About

CAS No 70315-70-7
English Name 3-Iodo-6-nitro-1H-indazole
Molecular Formula C7H4IN3O2
Molecular Weight 289.03 g/mol
SMILES C1=CC2=C(NN=C2C=C1[N+](=O)[O-])I
InChIKey GZCGNGLOCQEDMT-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

3-Iodo-6-nitro-1H-indazole is a crystalline solid with a molecular weight of approximately 268.03 g/...

Compound Q&A

What industries use 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

3-Iodo-6-nitro-1H-indazole is primarily used in the pharmaceutical industry for the development of p...

Compound Q&A

What precautions should be taken when handling 3-Iodo-6-nitro-1H-indazole (CAS: 70315-70-7)?

When handling 3-Iodo-6-nitro-1H-indazole, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...