Compound Q&A

What industries use 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

Answer

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II)
5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) is used in the pharmaceutical industry for developing photodynamic therapy drugs. It is also utilized in the semiconductor industry for doping materials and in sensor applications for detecting various analytes. Additionally, it finds applications in the synthesis of organometallic compounds and as a catalyst in certain chemical reactions.

About

CAS No 28903-71-1
English Name 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II)
Molecular Formula C48H36CoN4O4
Molecular Weight 791.8 g/mol
SMILES COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C=C4)C9=CC=C(C=C9)OC)[N-]3.[Co+2]
InChIKey QBCIMRXPMLWVML-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) is a solid with...

Compound Q&A

How is 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) typically synthesized?

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) is typically synthesized by react...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

When handling 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...