Compound Q&A

How is 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) typically synthesized?

Answer

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II)
5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) is typically synthesized by reacting 5,10,15,20-tetra(4-methoxyphenyl)porphine with cobalt(II) chloride in a suitable organic solvent. The reaction is conducted under mild conditions, often at room temperature, and the product can be isolated by filtration and recrystallization. The yield is generally high, with selectivity towards the desired cobalt(II) complex.

About

CAS No 28903-71-1
English Name 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II)
Molecular Formula C48H36CoN4O4
Molecular Weight 791.8 g/mol
SMILES COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C=C4)C9=CC=C(C=C9)OC)[N-]3.[Co+2]
InChIKey QBCIMRXPMLWVML-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) is a solid with...

Compound Q&A

What industries use 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1) is used in the ...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1)?

When handling 5,10,15,20-Tetrakis (4-methoxyphenyl)-21H,23H-porphine cobalt (II) (CAS: 28903-71-1), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...