Compound Q&A

How is (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0) typically synthesized?

Answer

(2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
This compound can be synthesized via a multistep process involving protection of the hydroxyl group, formation of the amide, and subsequent deprotection. Commonly used catalysts include acids or bases, and the reaction conditions are optimized for high yield and selectivity.

About

CAS No 1676-90-0
English Name (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
Molecular Formula C13H23NO6
Molecular Weight 289.33 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OC(C)(C)C
InChIKey PHJDCONJXLIIPW-QMMMGPOBSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

This compound is a crystalline solid with a molecular weight of approximately 324.43 g/mol. It is po...

Compound Q&A

What industries use (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

This compound finds applications in the pharmaceutical industry for the synthesis of biologically ac...

Compound Q&A

What precautions should be taken when handling (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

Proper personal protective equipment (PPE) such as gloves and goggles should be worn when handling t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...