Compound Q&A

What are the physical and chemical properties of (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

Answer

(2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
This compound is a crystalline solid with a molecular weight of approximately 324.43 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits typical ester and amide reactivity, making it useful in organic synthesis and pharmaceutical applications.

About

CAS No 1676-90-0
English Name (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
Molecular Formula C13H23NO6
Molecular Weight 289.33 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OC(C)(C)C
InChIKey PHJDCONJXLIIPW-QMMMGPOBSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0) typically synthesized?

This compound can be synthesized via a multistep process involving protection of the hydroxyl group,...

Compound Q&A

What industries use (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

This compound finds applications in the pharmaceutical industry for the synthesis of biologically ac...

Compound Q&A

What precautions should be taken when handling (2S)-4-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 1676-90-0)?

Proper personal protective equipment (PPE) such as gloves and goggles should be worn when handling t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...