Compound Q&A

What industries use 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

Answer

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid
2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) is primarily used in the pharmaceutical industry as a precursor for drug development. It has applications in polymers and sensors due to its unique chemical properties, but its most notable use is in the synthesis of medicinal compounds.

About

CAS No 4394-00-7
English Name 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid
Molecular Formula C13H9F3N2O2
Molecular Weight 282.22 g/mol
SMILES C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F
InChIKey JZFPYUNJRRFVQU-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) is a crystalline solid with a mo...

Compound Q&A

How is 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) typically synthesized?

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid is typically synthesized via amidation of nicotin...

Compound Q&A

What precautions should be taken when handling 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

When handling 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...