Compound Q&A

What are the physical and chemical properties of 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

Answer

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid
2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) is a crystalline solid with a molecular weight of approximately 333.14 g/mol. It has a solubility of about 5.8 mg/mL in water and is slightly soluble in ethanol. This compound is known for its high reactivity, particularly towards nucleophilic substitution reactions.

About

CAS No 4394-00-7
English Name 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid
Molecular Formula C13H9F3N2O2
Molecular Weight 282.22 g/mol
SMILES C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F
InChIKey JZFPYUNJRRFVQU-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) typically synthesized?

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid is typically synthesized via amidation of nicotin...

Compound Q&A

What industries use 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7)?

When handling 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinic acid (CAS: 4394-00-7), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...