Compound Q&A

How is Teneligliptin (CAS: 760937-92-6) typically synthesized?

Answer

Teneligliptin
Teneligliptin is synthesized via a multi-step process involving the coupling of a protected glycine with a benzamide using a coupling reagent like HATU in the presence of a base such as DIPEA. The key step involves the introduction of the amino group and subsequent protection and deprotection steps. The overall yield is around 50-60%, with high selectivity for the desired product.

About

English Name Teneligliptin
Molecular Formula C22H30N6OS
Molecular Weight 426.6 g/mol
SMILES CC1=NN(C(=C1)N2CCN(CC2)C3CC(NC3)C(=O)N4CCSC4)C5=CC=CC=C5
InChIKey WGRQANOPCQRCME-PMACEKPBSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Teneligliptin (CAS: 760937-92-6)?

Teneligliptin is a white to off-white crystalline powder. It has a molecular weight of approximately...

Compound Q&A

What industries use Teneligliptin (CAS: 760937-92-6)?

Teneligliptin is primarily used in the pharmaceutical industry for the treatment of type 2 diabetes....

Compound Q&A

What precautions should be taken when handling Teneligliptin (CAS: 760937-92-6)?

When handling Teneligliptin, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...