Compound Q&A

What precautions should be taken when handling 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8)?

Answer

2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide
When handling 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to air. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be well-ventilated. Safety data sheets (SDS) should always be consulted for detailed handling and disposal information. Storage should be in a dry, cool place, away from heat sources and oxidizing agents.

About

CAS No 55921-65-8
English Name 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide
Molecular Formula C8H13N5O
Molecular Weight 195.22 g/mol
SMILES C1CCN(C1)C2=NC(=N)N(C(=C2)N)O
InChIKey JOITXEDSRYVTLJ-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8)?

2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8) is a crystalline solid with a mo...

Compound Q&A

How is 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8) typically synthesized?

2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide is typically synthesized from 2,6-diaminopyrimidin...

Compound Q&A

What industries use 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8)?

2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide (CAS: 55921-65-8) is primarily used in the pharmac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...