Compound Q&A

What precautions should be taken when handling 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

Answer

3-Amino-4-chlorobenzenesulfonic acid
When handling 3-Amino-4-chlorobenzenesulfonic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be stored in a well-ventilated area away from heat sources and incompatible materials. In case of a spill, it should be cleaned up using appropriate methods, and safety data sheets (SDS) should be consulted for detailed information.

About

CAS No 98-36-2
English Name 3-Amino-4-chlorobenzenesulfonic acid
Molecular Formula C6H6ClNO3S
Molecular Weight 207.64 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)Cl
InChIKey XJQRCFRVWZHIPN-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

3-Amino-4-chlorobenzenesulfonic acid is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2) typically synthesized?

3-Amino-4-chlorobenzenesulfonic acid is typically synthesized by the reaction of 4-chlorobenzenesulf...

Compound Q&A

What industries use 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

3-Amino-4-chlorobenzenesulfonic acid is used in the pharmaceutical industry for the synthesis of var...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...