Compound Q&A

What industries use 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

Answer

3-Amino-4-chlorobenzenesulfonic acid
3-Amino-4-chlorobenzenesulfonic acid is used in the pharmaceutical industry for the synthesis of various drugs, in the polymer industry for the production of functional polymers, and in the sensor industry for the development of gas sensing devices. It is also employed in semiconductor applications for etching processes.

About

CAS No 98-36-2
English Name 3-Amino-4-chlorobenzenesulfonic acid
Molecular Formula C6H6ClNO3S
Molecular Weight 207.64 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)Cl
InChIKey XJQRCFRVWZHIPN-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

3-Amino-4-chlorobenzenesulfonic acid is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2) typically synthesized?

3-Amino-4-chlorobenzenesulfonic acid is typically synthesized by the reaction of 4-chlorobenzenesulf...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-chlorobenzenesulfonic acid (CAS: 98-36-2)?

When handling 3-Amino-4-chlorobenzenesulfonic acid, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...