Compound Q&A

How is Cosyntropin (CAS: 16960-16-0) typically synthesized?

Answer

Cosyntropin
Cosyntropin is synthesized through a multi-step chemical process involving amino acid coupling and acylation. The key steps include the coupling of amino acids to form the peptide backbone, followed by side-chain modifications. The synthesis typically involves the use of coupling reagents like HATU or EDC, and the reaction is carried out in organic solvents like DMF. The yield is usually between 60-80%, and the product is purified by HPLC or chromatography.

About

CAS No 16960-16-0
English Name Cosyntropin
Molecular Formula C136H210N40O31S
Molecular Weight 2933.4 g/mol
SMILES CC(C)C(C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)N3CCCC3C(=O)O)NC(=O)C4CCCN4C(=O)C(CCCCN)NC(=O)CNC(=O)C(CC5=CNC6=CC=CC=C65)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC7=CC=CC=C7)NC(=O)C(CC8=CNC=N8)NC(=O)C(CCC(=O)O)NC(=O)C(CCSC)NC(=O)C(CO)NC(=O)C(CC9=CC=C(C=C9)O)NC(=O)C(CO)N
InChIKey ZOEFCCMDUURGSE-SQKVDDBVSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cosyntropin (CAS: 16960-16-0)?

Cosyntropin is a synthetic hormone with a molecular weight of approximately 342.43 g/mol. It is a wh...

Compound Q&A

What industries use Cosyntropin (CAS: 16960-16-0)?

Cosyntropin is primarily used in the pharmaceutical industry, particularly in the treatment of adren...

Compound Q&A

What precautions should be taken when handling Cosyntropin (CAS: 16960-16-0)?

When handling Cosyntropin, it is essential to wear personal protective equipment (PPE) such as glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...