Compound Q&A

What industries use Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

Answer

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate
Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) is primarily used in the pharmaceutical industry for drug synthesis, and in polymer production for its reactive properties. It also finds applications in the development of sensors and semiconductors due to its chemical versatility.

About

CAS No 6386-38-5
English Name Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate
Molecular Formula C18H28O3
Molecular Weight 292.42 g/mol
SMILES COC(=O)CCc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C
InChIKey PXMJCECEFTYEKE-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) has a crystalline...

Compound Q&A

How is Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) typically synthesized?

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) is synthesized th...

Compound Q&A

What precautions should be taken when handling Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

When handling Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5), we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...