Compound Q&A

What are the physical and chemical properties of Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

Answer

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate
Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) has a crystalline form and a molecular weight of approximately 364.5 g/mol. It has low solubility in water but is soluble in organic solvents like ethanol and acetone. It shows moderate reactivity in organic reactions, particularly ester hydrolysis and esterification.

About

CAS No 6386-38-5
English Name Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate
Molecular Formula C18H28O3
Molecular Weight 292.42 g/mol
SMILES COC(=O)CCc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C
InChIKey PXMJCECEFTYEKE-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) typically synthesized?

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) is synthesized th...

Compound Q&A

What industries use Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5) is primarily used...

Compound Q&A

What precautions should be taken when handling Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5)?

When handling Methyl 3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate (CAS: 6386-38-5), we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...