Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]acetic acid (CAS: 351-35-9)?

Answer

[3-(Trifluoromethyl)phenyl]acetic acid
The compound [3-(Trifluoromethyl)phenyl]acetic acid is used in various industries, including pharmaceuticals for development of drug candidates, polymers for specialized applications, and sensors for detecting certain chemicals or biological agents. Its unique physical and chemical properties make it valuable in these sectors.

About

CAS No 351-35-9
English Name [3-(Trifluoromethyl)phenyl]acetic acid
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CC(=O)O
InChIKey BLXXCCIBGGBDHI-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]acetic acid (CAS: 351-35-9)?

The physical properties of [3-(Trifluoromethyl)phenyl]acetic acid include a white to off-white cryst...

Compound Q&A

How is [3-(Trifluoromethyl)phenyl]acetic acid (CAS: 351-35-9) typically synthesized?

Common synthesis methods for [3-(Trifluoromethyl)phenyl]acetic acid involve the reaction of 3-(trifl...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]acetic acid (CAS: 351-35-9)?

When handling [3-(Trifluoromethyl)phenyl]acetic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...