Compound Q&A

What industries use 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

Answer

1,3,6,8-Tetrabromopyrene
1,3,6,8-Tetrabromopyrene is used in the pharmaceutical industry for the development of anticancer drugs, in the polymer industry as a flame retardant, in sensor technology for detection of harmful gases, and in semiconductor manufacturing for specific applications requiring high purity materials.

About

CAS No 128-63-2
English Name 1,3,6,8-Tetrabromopyrene
Molecular Formula C16H6Br4
Molecular Weight 517.84 g/mol
SMILES C1=CC2=C3C(=C(C=C2Br)Br)C=CC4=C(C=C(C1=C43)Br)Br
InChIKey ZKBKRTZIYOKNRG-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

1,3,6,8-Tetrabromopyrene (CAS: 128-63-2) is a solid with a melting point of approximately 270°C. Its...

Compound Q&A

How is 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2) typically synthesized?

1,3,6,8-Tetrabromopyrene is typically synthesized through bromination of pyrene using bromine in the...

Compound Q&A

What precautions should be taken when handling 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

When handling 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2), it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...