Compound Q&A

What are the physical and chemical properties of 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

Answer

1,3,6,8-Tetrabromopyrene
1,3,6,8-Tetrabromopyrene (CAS: 128-63-2) is a solid with a melting point of approximately 270°C. Its molecular weight is around 532.28 g/mol. It has low water solubility but is soluble in organic solvents such as chloroform and benzene. It is relatively stable under normal conditions but reacts with reducing agents to form lower brominated pyrenes.

About

CAS No 128-63-2
English Name 1,3,6,8-Tetrabromopyrene
Molecular Formula C16H6Br4
Molecular Weight 517.84 g/mol
SMILES C1=CC2=C3C(=C(C=C2Br)Br)C=CC4=C(C=C(C1=C43)Br)Br
InChIKey ZKBKRTZIYOKNRG-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2) typically synthesized?

1,3,6,8-Tetrabromopyrene is typically synthesized through bromination of pyrene using bromine in the...

Compound Q&A

What industries use 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

1,3,6,8-Tetrabromopyrene is used in the pharmaceutical industry for the development of anticancer dr...

Compound Q&A

What precautions should be taken when handling 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2)?

When handling 1,3,6,8-Tetrabromopyrene (CAS: 128-63-2), it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...