Compound Q&A

What industries use 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

Answer

1,2,3,4-Tetrafluoro-5-nitrobenzene
1,2,3,4-Tetrafluoro-5-nitrobenzene is mainly used in the pharmaceutical and polymer industries. It serves as a precursor for various medicinal compounds and can also be used in the synthesis of fluorinated polymers. Additionally, it finds applications in the development of sensors and as a component in semiconductor materials due to its unique chemical properties.

About

CAS No 5580-79-0
English Name 1,2,3,4-Tetrafluoro-5-nitrobenzene
Molecular Formula C6HF4NO2
Molecular Weight 195.07 g/mol
SMILES C1=C(C(=C(C(=C1F)F)F)F)[N+](=O)[O-]
InChIKey MKMDVNZEIQDZEP-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

1,2,3,4-Tetrafluoro-5-nitrobenzene is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0) typically synthesized?

1,2,3,4-Tetrafluoro-5-nitrobenzene can be synthesized via nitration of 1,2,3,4-tetrafluorobenzene us...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

When handling 1,2,3,4-Tetrafluoro-5-nitrobenzene, it is essential to use proper personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...