Compound Q&A

How is 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0) typically synthesized?

Answer

1,2,3,4-Tetrafluoro-5-nitrobenzene
1,2,3,4-Tetrafluoro-5-nitrobenzene can be synthesized via nitration of 1,2,3,4-tetrafluorobenzene using concentrated nitric acid and sulfuric acid as the acid catalyst. The reaction is typically carried out at low temperature to control the reaction selectivity. The yield of the product is usually around 70-80%, and the method requires proper handling of the nitric acid to prevent unintended side reactions.

About

CAS No 5580-79-0
English Name 1,2,3,4-Tetrafluoro-5-nitrobenzene
Molecular Formula C6HF4NO2
Molecular Weight 195.07 g/mol
SMILES C1=C(C(=C(C(=C1F)F)F)F)[N+](=O)[O-]
InChIKey MKMDVNZEIQDZEP-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

1,2,3,4-Tetrafluoro-5-nitrobenzene is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

1,2,3,4-Tetrafluoro-5-nitrobenzene is mainly used in the pharmaceutical and polymer industries. It s...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrafluoro-5-nitrobenzene (CAS: 5580-79-0)?

When handling 1,2,3,4-Tetrafluoro-5-nitrobenzene, it is essential to use proper personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...