Compound Q&A

What precautions should be taken when handling 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

Answer

5-Hydroxyisophthalic acid
When handling 5-Hydroxyisophthalic acid (CAS: 618-83-7), it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Handle in a well-ventilated area or fume hood to minimize inhalation risks. Ensure the spill is cleaned up immediately with appropriate absorbents and dispose of waste according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed instructions on handling and emergency procedures.

About

CAS No 618-83-7
English Name 5-Hydroxyisophthalic acid
Molecular Formula C8H6O5
Molecular Weight 182.13 g/mol
SMILES C1=C(C=C(C=C1C(=O)O)O)C(=O)O
InChIKey QNVNLUSHGRBCLO-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

5-Hydroxyisophthalic acid is a white crystalline solid with a molecular weight of approximately 186....

Compound Q&A

How is 5-Hydroxyisophthalic acid (CAS: 618-83-7) typically synthesized?

5-Hydroxyisophthalic acid is usually synthesized via the hydroxylation of isophthalic acid. The hydr...

Compound Q&A

What industries use 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

5-Hydroxyisophthalic acid is used in various industries, including pharmaceuticals, where it serves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...