Compound Q&A

How is 5-Hydroxyisophthalic acid (CAS: 618-83-7) typically synthesized?

Answer

5-Hydroxyisophthalic acid
5-Hydroxyisophthalic acid is usually synthesized via the hydroxylation of isophthalic acid. The hydroxylation can be achieved using catalytic hydrogen peroxide in the presence of a suitable catalyst such as sodium hypochlorite or cobalt(II) salts. The reaction is selective and yields up to 95% of the desired product with good purity.

About

CAS No 618-83-7
English Name 5-Hydroxyisophthalic acid
Molecular Formula C8H6O5
Molecular Weight 182.13 g/mol
SMILES C1=C(C=C(C=C1C(=O)O)O)C(=O)O
InChIKey QNVNLUSHGRBCLO-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

5-Hydroxyisophthalic acid is a white crystalline solid with a molecular weight of approximately 186....

Compound Q&A

What industries use 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

5-Hydroxyisophthalic acid is used in various industries, including pharmaceuticals, where it serves ...

Compound Q&A

What precautions should be taken when handling 5-Hydroxyisophthalic acid (CAS: 618-83-7)?

When handling 5-Hydroxyisophthalic acid (CAS: 618-83-7), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...