Compound Q&A

What precautions should be taken when handling 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

Answer

1,1,1-Triphenylmethanamine
When handling 1,1,1-Triphenylmethanamine (CAS: 5824-40-8), safety precautions such as wearing personal protective equipment (PPE) like gloves, goggles, and a lab coat are essential. The substance should be handled in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials. Emergency procedures and access to a safety data sheet (SDS) for first aid and further information are critical. Storage should be in a cool, dry, and well-ventilated area away from incompatible materials.

About

CAS No 5824-40-8
English Name 1,1,1-Triphenylmethanamine
Molecular Formula C19H17N
Molecular Weight 259.35 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N
InChIKey BZVJOYBTLHNRDW-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

1,1,1-Triphenylmethanamine (CAS: 5824-40-8) is a colorless crystalline solid with a molecular weight...

Compound Q&A

How is 1,1,1-Triphenylmethanamine (CAS: 5824-40-8) typically synthesized?

1,1,1-Triphenylmethanamine (CAS: 5824-40-8) is typically synthesized by the reaction of phenylmethyl...

Compound Q&A

What industries use 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

1,1,1-Triphenylmethanamine (CAS: 5824-40-8) finds applications in various industries. It is widely u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...