Compound Q&A

What are the physical and chemical properties of 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

Answer

1,1,1-Triphenylmethanamine
1,1,1-Triphenylmethanamine (CAS: 5824-40-8) is a colorless crystalline solid with a molecular weight of approximately 268.21 g/mol. It has a melting point of 135-137°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is an amine derivative that undergoes typical amine reactions such as alkylation and acylation. It is less reactive compared to primary amines but exhibits electrophilic substitution reactions under certain conditions.

About

CAS No 5824-40-8
English Name 1,1,1-Triphenylmethanamine
Molecular Formula C19H17N
Molecular Weight 259.35 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N
InChIKey BZVJOYBTLHNRDW-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 1,1,1-Triphenylmethanamine (CAS: 5824-40-8) typically synthesized?

1,1,1-Triphenylmethanamine (CAS: 5824-40-8) is typically synthesized by the reaction of phenylmethyl...

Compound Q&A

What industries use 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

1,1,1-Triphenylmethanamine (CAS: 5824-40-8) finds applications in various industries. It is widely u...

Compound Q&A

What precautions should be taken when handling 1,1,1-Triphenylmethanamine (CAS: 5824-40-8)?

When handling 1,1,1-Triphenylmethanamine (CAS: 5824-40-8), safety precautions such as wearing person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...