Compound Q&A

How is 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) typically synthesized?

Answer

2,3-Difluoro Benzoic Acid
2,3-Difluoro Benzoic Acid is typically synthesized by the fluoride substitution of benzoic acid. This can be achieved through the reaction of benzoic acid with a fluoride source like hydrogen fluoride (HF) or trifluoromethanesulfonic acid (TFMSA) in the presence of a Lewis acid catalyst, such as aluminum chloride (AlCl₃). The reaction is exothermic and requires careful control to maintain high yield and selectivity.

About

CAS No 4519-39-5
English Name 2,3-Difluoro Benzoic Acid
Molecular Formula C7H4F2O2
Molecular Weight 158.1 g/mol
SMILES C1=CC(=C(C(=C1)F)F)C(=O)O
InChIKey JLZVIWSFUPLSOR-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) is used in various industries. It is an important interme...

Compound Q&A

What precautions should be taken when handling 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

When handling 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...