Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

Answer

2,3-Difluoro Benzoic Acid
2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) is a white crystalline solid with a molecular weight of approximately 181.06 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is a weak acid and can undergo reactions typical of carboxylic acids, such as esterification and amide formation. It is relatively stable under normal conditions but can decompose when exposed to strong bases or high temperatures.

About

CAS No 4519-39-5
English Name 2,3-Difluoro Benzoic Acid
Molecular Formula C7H4F2O2
Molecular Weight 158.1 g/mol
SMILES C1=CC(=C(C(=C1)F)F)C(=O)O
InChIKey JLZVIWSFUPLSOR-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) typically synthesized?

2,3-Difluoro Benzoic Acid is typically synthesized by the fluoride substitution of benzoic acid. Thi...

Compound Q&A

What industries use 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

2,3-Difluoro Benzoic Acid (CAS: 4519-39-5) is used in various industries. It is an important interme...

Compound Q&A

What precautions should be taken when handling 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5)?

When handling 2,3-Difluoro Benzoic Acid (CAS: 4519-39-5), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...