Compound Q&A

How is 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) typically synthesized?

Answer

2-Naphthylhydrazine hydrochloride (1:1)
2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is typically synthesized by the reaction of 2-naphthylhydrazine with hydrochloric acid. This process involves the formation of the salt form, which enhances solubility and stability. The synthesis is carried out under mild conditions, with high selectivity and yield.

About

CAS No 2243-58-5
English Name 2-Naphthylhydrazine hydrochloride (1:1)
Molecular Formula C10H11ClN2
Molecular Weight 194.665 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)NN.Cl
InChIKey OXOQKRNEPBHINU-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is used in several industries, including pharmace...

Compound Q&A

What precautions should be taken when handling 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

When handling 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5), it is essential to use personal pr...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...