Compound Q&A

What are the physical and chemical properties of 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

Answer

2-Naphthylhydrazine hydrochloride (1:1)
2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is a crystalline solid with a molecular weight of approximately 239.7 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is known for its reactivity, particularly in condensation reactions and as a reducing agent in organic synthesis. It is used in various applications requiring controlled reactivity.

About

CAS No 2243-58-5
English Name 2-Naphthylhydrazine hydrochloride (1:1)
Molecular Formula C10H11ClN2
Molecular Weight 194.67 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)NN.Cl
InChIKey OXOQKRNEPBHINU-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) typically synthesized?

2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is typically synthesized by the reaction of 2-nap...

Compound Q&A

What industries use 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5) is used in several industries, including pharmace...

Compound Q&A

What precautions should be taken when handling 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5)?

When handling 2-Naphthylhydrazine hydrochloride (CAS: 2243-58-5), it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...